Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Sulfametomidine: Difference between pages

(Difference between pages)
Content deleted Content added
VisualWikitext
Saving copy of the {{drugbox}} taken from revid 457244399 of page Sulfametomidine for the Chem/Drugbox validation project (updated: 'CAS_number').
 
reference
 
Line 1: Line 1:
{{Short description|Chemical compound}}
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Sulfametomidine|oldid=457244399}} 457244399] of page [[Sulfametomidine]] with values updated to verified values.}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| Verifiedfields = changed
⚫
| verifiedrevid =
| Watchedfields = changed
⚫
| verifiedrevid = 418124607
| IUPAC_name = 4-amino-''N''-(6-methoxy-2-methylpyrimidin-4-yl)<br>benzenesulfonamide
| IUPAC_name = 4-amino-''N''-(6-methoxy-2-methylpyrimidin-4-yl)<br>benzenesulfonamide
| image = Sulfametomidine.svg
| image = Sulfametomidine.svg


<!--Clinical data-->
<!--Clinical data-->
| tradename =
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| legal_status =
| routes_of_administration = Oral
| routes_of_administration = Oral


<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
| bioavailability =
| bioavailability =
| protein_bound =
| protein_bound =
| metabolism =
| metabolism =
| elimination_half-life = 27 hours
| elimination_half-life = 27 hours
| excretion = [[Kidney|Renal]]
| excretion = [[Kidney|Renal]]


<!--Identifiers-->
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number_Ref = {{cascite||??}}
| CAS_number = <!-- blanked - oldvalue: 3772-76-7 -->
| CAS_number = 3772-76-7
| ATC_prefix = J01
| ATC_prefix = J01
| ATC_suffix = ED03
| ATC_suffix = ED03
| PubChem = 19596
| PubChem = 19596
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 18460
| ChemSpiderID = 18460
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII_Ref = {{fdacite||FDA}}
| UNII = 940ZL3AHKB
| UNII = 940ZL3AHKB
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL_Ref = {{ebicite|correct|EBI}}
Line 42: Line 41:


<!--Chemical data-->
<!--Chemical data-->
| C=12 | H=14 | N=4 | O=3 | S=1
| C=12 | H=14 | N=4 | O=3 | S=1
| molecular_weight = 294.331 g/mol
| smiles = O=S(=O)(Nc1nc(nc(OC)c1)C)c2ccc(N)cc2
| smiles = O=S(=O)(Nc1nc(nc(OC)c1)C)c2ccc(N)cc2
| InChI = 1/C12H14N4O3S/c1-8-14-11(7-12(15-8)19-2)16-20(17,18)10-5-3-9(13)4-6-10/h3-7H,13H2,1-2H3,(H,14,15,16)
| InChIKey = QKLSCPPJEVXONT-UHFFFAOYAH
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H14N4O3S/c1-8-14-11(7-12(15-8)19-2)16-20(17,18)10-5-3-9(13)4-6-10/h3-7H,13H2,1-2H3,(H,14,15,16)
| StdInChI = 1S/C12H14N4O3S/c1-8-14-11(7-12(15-8)19-2)16-20(17,18)10-5-3-9(13)4-6-10/h3-7H,13H2,1-2H3,(H,14,15,16)
Line 52: Line 48:
| StdInChIKey = QKLSCPPJEVXONT-UHFFFAOYSA-N
| StdInChIKey = QKLSCPPJEVXONT-UHFFFAOYSA-N
}}
}}

'''Sulfametomidine''' (or '''sulfamethomidine''') is a [[sulfonamide (medicine)|sulfonamide]] [[antibacterial]].<ref>{{cite web | url = https://drugs.ncats.io/drug/940ZL3AHKB | title = Sulfametomidine | work = Inxight Drugs | publisher = National Center for Advancing Translational Sciences }}</ref>

==References==
{{Reflist}}

{{Sulfonamides and trimethoprim}}

[[Category:Sulfonamide antibiotics]]
[[Category:Pyrimidines]]
[[Category:Phenol ethers]]


{{antibiotic-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"